C15H13N3O5 — CID 4582085
N-(2-ethylphenyl)-2,4-dinitrobenzamide (PubChem CID 4582085) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,4-dinitrobenzamide.
| Compound Name | N-(2-ethylphenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 4582085 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(2-ethylphenyl)-2,4-dinitrobenzamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O5/c1-2-10-5-3-4-6-13(10)16-15(19)12-8-7-11(17(20)21)9-14(12)18(22)23/h3-9H,2H2,1H3,(H,16,19) |
| InChIKey | VJNUFBNCVNLHAD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|