C19H13N3O6 — CID 4693634
2,4-dinitro-N-(2-phenoxyphenyl)benzamide (PubChem CID 4693634) has the molecular formula C19H13N3O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is 2,4-dinitro-N-(2-phenoxyphenyl)benzamide.
| Compound Name | 2,4-dinitro-N-(2-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4693634 |
| Molecular Formula | C19H13N3O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2,4-dinitro-N-(2-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H13N3O6/c23-19(15-11-10-13(21(24)25)12-17(15)22(26)27)20-16-8-4-5-9-18(16)28-14-6-2-1-3-7-14/h1-12H,(H,20,23) |
| InChIKey | JCGWPFDSQVYMRG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|