C19H11F3N2O4 — CID 55752798
5-nitro-2-phenoxy-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 55752798) has the molecular formula C19H11F3N2O4 and a molecular weight of 388.30 g/mol. Its IUPAC name is 5-nitro-2-phenoxy-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 5-nitro-2-phenoxy-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 55752798 |
| Molecular Formula | C19H11F3N2O4 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 5-nitro-2-phenoxy-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cc([N+](=O)[O-])ccc1Oc1ccccc1 |
| InChI | InChI=1S/C19H11F3N2O4/c20-14-7-8-15(18(22)17(14)21)23-19(25)13-10-11(24(26)27)6-9-16(13)28-12-4-2-1-3-5-12/h1-10H,(H,23,25) |
| InChIKey | DNJZPNFRAHNVCD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|