About 5-nitro-2-phenoxybenzoyl chloride
5-nitro-2-phenoxybenzoyl chloride (PubChem CID 21406549) has the molecular formula C13H8ClNO4
and a molecular weight of 277.66 g/mol. Its IUPAC name is 5-nitro-2-phenoxybenzoyl chloride.
Molecular Properties
| Compound Name | 5-nitro-2-phenoxybenzoyl chloride |
| PubChem CID | 21406549 |
| Molecular Formula | C13H8ClNO4 |
| Molecular Weight | 277.66 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-nitro-2-phenoxybenzoyl chloride |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])ccc1Oc1ccccc1 |
| InChI | InChI=1S/C13H8ClNO4/c14-13(16)11-8-9(15(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H |
| InChIKey | GSOCUQJYEXBKND-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-phenoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-phenoxybenzoyl chloride?
The IUPAC name of 5-nitro-2-phenoxybenzoyl chloride (CID 21406549) is 5-nitro-2-phenoxybenzoyl chloride.
What is the SMILES notation for 5-nitro-2-phenoxybenzoyl chloride?
The canonical SMILES for 5-nitro-2-phenoxybenzoyl chloride is O=C(Cl)c1cc([N+](=O)[O-])ccc1Oc1ccccc1.
What is the InChIKey of 5-nitro-2-phenoxybenzoyl chloride?
The InChIKey is GSOCUQJYEXBKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO4/c14-13(16)11-8-9(15(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H.
What are the key properties of 5-nitro-2-phenoxybenzoyl chloride?
5-nitro-2-phenoxybenzoyl chloride has a molecular weight of 277.66 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-phenoxybenzoyl chloride is sourced from PubChem (CID 21406549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).