5-nitro-2-phenoxybenzoyl chloride

C13H8ClNO4 — CID 21406549

IUPAC5-nitro-2-phenoxybenzoyl chloride
SMILESO=C(Cl)c1cc([N+](=O)[O-])ccc1Oc1ccccc1
InChIInChI=1S/C13H8ClNO4/c14-13(16)11-8-9(15(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H
InChIKeyGSOCUQJYEXBKND-UHFFFAOYSA-N
MW277.66 g/mol
LogP3.77
Rot. Bonds4

About 5-nitro-2-phenoxybenzoyl chloride

5-nitro-2-phenoxybenzoyl chloride (PubChem CID 21406549) has the molecular formula C13H8ClNO4 and a molecular weight of 277.66 g/mol. Its IUPAC name is 5-nitro-2-phenoxybenzoyl chloride.

Molecular Properties

Compound Name5-nitro-2-phenoxybenzoyl chloride
PubChem CID21406549
Molecular FormulaC13H8ClNO4
Molecular Weight277.66 g/mol
Exact Mass277.01
IUPAC Name5-nitro-2-phenoxybenzoyl chloride
SMILESO=C(Cl)c1cc([N+](=O)[O-])ccc1Oc1ccccc1
InChIInChI=1S/C13H8ClNO4/c14-13(16)11-8-9(15(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H
InChIKeyGSOCUQJYEXBKND-UHFFFAOYSA-N
XLogP3.77
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.66
LogP ≤ 53.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-nitro-2-phenoxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-nitro-2-phenoxybenzoyl chloride?
The IUPAC name of 5-nitro-2-phenoxybenzoyl chloride (CID 21406549) is 5-nitro-2-phenoxybenzoyl chloride.
What is the SMILES notation for 5-nitro-2-phenoxybenzoyl chloride?
The canonical SMILES for 5-nitro-2-phenoxybenzoyl chloride is O=C(Cl)c1cc([N+](=O)[O-])ccc1Oc1ccccc1.
What is the InChIKey of 5-nitro-2-phenoxybenzoyl chloride?
The InChIKey is GSOCUQJYEXBKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO4/c14-13(16)11-8-9(15(17)18)6-7-12(11)19-10-4-2-1-3-5-10/h1-8H.
What are the key properties of 5-nitro-2-phenoxybenzoyl chloride?
5-nitro-2-phenoxybenzoyl chloride has a molecular weight of 277.66 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-phenoxybenzoyl chloride is sourced from PubChem (CID 21406549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).