C19H13NO4 — CID 71751591
[2-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)-4-nitrophenyl]-phenylmethanone (PubChem CID 71751591) has the molecular formula C19H13NO4 and a molecular weight of 325.27 g/mol. Its IUPAC name is [2-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)-4-nitrophenyl]-phenylmethanone.
| Compound Name | [2-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)-4-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 71751591 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-((1,2,3,4,5,6-13C6)cyclohexatrienyloxy)-4-nitrophenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1O[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C19H13NO4/c21-19(14-7-3-1-4-8-14)17-12-11-15(20(22)23)13-18(17)24-16-9-5-2-6-10-16/h1-13H/i2+1,5+1,6+1,9+1,10+1,16+1 |
| InChIKey | QXRROUXILAFNBG-VSXUSETJSA-N |
| XLogP | 4.62 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|