C25H16N2O7 — CID 139816675
[3,4-bis(4-nitrophenoxy)phenyl]-phenylmethanone (PubChem CID 139816675) has the molecular formula C25H16N2O7 and a molecular weight of 456.41 g/mol. Its IUPAC name is [3,4-bis(4-nitrophenoxy)phenyl]-phenylmethanone.
| Compound Name | [3,4-bis(4-nitrophenoxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 139816675 |
| Molecular Formula | C25H16N2O7 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [3,4-bis(4-nitrophenoxy)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(Oc2ccc([N+](=O)[O-])cc2)c(Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H16N2O7/c28-25(17-4-2-1-3-5-17)18-6-15-23(33-21-11-7-19(8-12-21)26(29)30)24(16-18)34-22-13-9-20(10-14-22)27(31)32/h1-16H |
| InChIKey | WQQSFNRPQVZUPQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|