About [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium
[3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium (PubChem CID 88696344) has the molecular formula C26H16N2O7Pd
and a molecular weight of 574.84 g/mol. Its IUPAC name is [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium.
Molecular Properties
| Compound Name | [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium |
| PubChem CID | 88696344 |
| Molecular Formula | C26H16N2O7Pd |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.00 |
| IUPAC Name | [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1cccc(Oc2cccc(C(=O)c3ccc([N+](=O)[O-])cc3)c2)c1.[Pd] |
| InChI | InChI=1S/C26H16N2O7.Pd/c29-25(17-7-11-21(12-8-17)27(31)32)19-3-1-5-23(15-19)35-24-6-2-4-20(16-24)26(30)18-9-13-22(14-10-18)28(33)34;/h1-16H; |
| InChIKey | IVHKGNJXNOFXGE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium?
The IUPAC name of [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium (CID 88696344) is [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium.
What is the SMILES notation for [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium?
The canonical SMILES for [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium is O=C(c1ccc([N+](=O)[O-])cc1)c1cccc(Oc2cccc(C(=O)c3ccc([N+](=O)[O-])cc3)c2)c1.[Pd].
What is the InChIKey of [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium?
The InChIKey is IVHKGNJXNOFXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16N2O7.Pd/c29-25(17-7-11-21(12-8-17)27(31)32)19-3-1-5-23(15-19)35-24-6-2-4-20(16-24)26(30)18-9-13-22(14-10-18)28(33)34;/h1-16H;.
What are the key properties of [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium?
[3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium has a molecular weight of 574.84 g/mol, XLogP of 5.75, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(4-nitrobenzoyl)phenoxy]phenyl]-(4-nitrophenyl)methanone;palladium is sourced from PubChem (CID 88696344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).