About dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone
dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone (PubChem CID 174857907) has the molecular formula C19H16NO6PS
and a molecular weight of 417.38 g/mol. Its IUPAC name is dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone |
| PubChem CID | 174857907 |
| Molecular Formula | C19H16NO6PS |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.OP(O)(=S)Oc1ccccc1 |
| InChI | InChI=1S/C13H9NO3.C6H7O3PS/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;7-10(8,11)9-6-4-2-1-3-5-6/h1-9H;1-5H,(H2,7,8,11) |
| InChIKey | CAISBDAVOWTRBP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone?
The IUPAC name of dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone (CID 174857907) is dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone.
What is the SMILES notation for dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone?
The canonical SMILES for dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone is O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.OP(O)(=S)Oc1ccccc1.
What is the InChIKey of dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone?
The InChIKey is CAISBDAVOWTRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C6H7O3PS/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;7-10(8,11)9-6-4-2-1-3-5-6/h1-9H;1-5H,(H2,7,8,11).
What are the key properties of dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone?
dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone has a molecular weight of 417.38 g/mol, XLogP of 4.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-phenoxy-sulfanylidene-λ5-phosphane;(4-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174857907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).