About carbamodithioic acid;(4-nitrophenyl)-phenylmethanone
carbamodithioic acid;(4-nitrophenyl)-phenylmethanone (PubChem CID 174955967) has the molecular formula C14H12N2O3S2
and a molecular weight of 320.40 g/mol. Its IUPAC name is carbamodithioic acid;(4-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | carbamodithioic acid;(4-nitrophenyl)-phenylmethanone |
| PubChem CID | 174955967 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | carbamodithioic acid;(4-nitrophenyl)-phenylmethanone |
| SMILES | NC(=S)S.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.CH3NS2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1(3)4/h1-9H;(H3,2,3,4) |
| InChIKey | JNNPPULHOUFVKS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;(4-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;(4-nitrophenyl)-phenylmethanone?
The IUPAC name of carbamodithioic acid;(4-nitrophenyl)-phenylmethanone (CID 174955967) is carbamodithioic acid;(4-nitrophenyl)-phenylmethanone.
What is the SMILES notation for carbamodithioic acid;(4-nitrophenyl)-phenylmethanone?
The canonical SMILES for carbamodithioic acid;(4-nitrophenyl)-phenylmethanone is NC(=S)S.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of carbamodithioic acid;(4-nitrophenyl)-phenylmethanone?
The InChIKey is JNNPPULHOUFVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.CH3NS2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;2-1(3)4/h1-9H;(H3,2,3,4).
What are the key properties of carbamodithioic acid;(4-nitrophenyl)-phenylmethanone?
carbamodithioic acid;(4-nitrophenyl)-phenylmethanone has a molecular weight of 320.40 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;(4-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174955967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).