About 5-nitro-2-phenylbenzoyl chloride
5-nitro-2-phenylbenzoyl chloride (PubChem CID 21406523) has the molecular formula C13H8ClNO3
and a molecular weight of 261.66 g/mol. Its IUPAC name is 5-nitro-2-phenylbenzoyl chloride.
Molecular Properties
| Compound Name | 5-nitro-2-phenylbenzoyl chloride |
| PubChem CID | 21406523 |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 5-nitro-2-phenylbenzoyl chloride |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])ccc1-c1ccccc1 |
| InChI | InChI=1S/C13H8ClNO3/c14-13(16)12-8-10(15(17)18)6-7-11(12)9-4-2-1-3-5-9/h1-8H |
| InChIKey | BTSVXXYBGKUIEA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-phenylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-phenylbenzoyl chloride?
The IUPAC name of 5-nitro-2-phenylbenzoyl chloride (CID 21406523) is 5-nitro-2-phenylbenzoyl chloride.
What is the SMILES notation for 5-nitro-2-phenylbenzoyl chloride?
The canonical SMILES for 5-nitro-2-phenylbenzoyl chloride is O=C(Cl)c1cc([N+](=O)[O-])ccc1-c1ccccc1.
What is the InChIKey of 5-nitro-2-phenylbenzoyl chloride?
The InChIKey is BTSVXXYBGKUIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO3/c14-13(16)12-8-10(15(17)18)6-7-11(12)9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-nitro-2-phenylbenzoyl chloride?
5-nitro-2-phenylbenzoyl chloride has a molecular weight of 261.66 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-phenylbenzoyl chloride is sourced from PubChem (CID 21406523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).