(4-nitro-2-phenylphenyl) hydrogen carbonate

C13H9NO5 — CID 53438460

IUPAC(4-nitro-2-phenylphenyl) hydrogen carbonate
SMILESO=C(O)Oc1ccc([N+](=O)[O-])cc1-c1ccccc1
InChIInChI=1S/C13H9NO5/c15-13(16)19-12-7-6-10(14(17)18)8-11(12)9-4-2-1-3-5-9/h1-8H,(H,15,16)
InChIKeyFYJFQBNUQCDIRL-UHFFFAOYSA-N
MW259.22 g/mol
LogP3.32
Rot. Bonds3

About (4-nitro-2-phenylphenyl) hydrogen carbonate

(4-nitro-2-phenylphenyl) hydrogen carbonate (PubChem CID 53438460) has the molecular formula C13H9NO5 and a molecular weight of 259.22 g/mol. Its IUPAC name is (4-nitro-2-phenylphenyl) hydrogen carbonate.

Molecular Properties

Compound Name(4-nitro-2-phenylphenyl) hydrogen carbonate
PubChem CID53438460
Molecular FormulaC13H9NO5
Molecular Weight259.22 g/mol
Exact Mass259.05
IUPAC Name(4-nitro-2-phenylphenyl) hydrogen carbonate
SMILESO=C(O)Oc1ccc([N+](=O)[O-])cc1-c1ccccc1
InChIInChI=1S/C13H9NO5/c15-13(16)19-12-7-6-10(14(17)18)8-11(12)9-4-2-1-3-5-9/h1-8H,(H,15,16)
InChIKeyFYJFQBNUQCDIRL-UHFFFAOYSA-N
XLogP3.32
TPSA89.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.22
LogP ≤ 53.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze (4-nitro-2-phenylphenyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-nitro-2-phenylphenyl) hydrogen carbonate?
The IUPAC name of (4-nitro-2-phenylphenyl) hydrogen carbonate (CID 53438460) is (4-nitro-2-phenylphenyl) hydrogen carbonate.
What is the SMILES notation for (4-nitro-2-phenylphenyl) hydrogen carbonate?
The canonical SMILES for (4-nitro-2-phenylphenyl) hydrogen carbonate is O=C(O)Oc1ccc([N+](=O)[O-])cc1-c1ccccc1.
What is the InChIKey of (4-nitro-2-phenylphenyl) hydrogen carbonate?
The InChIKey is FYJFQBNUQCDIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO5/c15-13(16)19-12-7-6-10(14(17)18)8-11(12)9-4-2-1-3-5-9/h1-8H,(H,15,16).
What are the key properties of (4-nitro-2-phenylphenyl) hydrogen carbonate?
(4-nitro-2-phenylphenyl) hydrogen carbonate has a molecular weight of 259.22 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-2-phenylphenyl) hydrogen carbonate is sourced from PubChem (CID 53438460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).