C32H20N6O12 — CID 3095747
N-[4-[3-[4-[(2,4-dinitrobenzoyl)amino]phenoxy]phenoxy]phenyl]-2,4-dinitrobenzamide (PubChem CID 3095747) has the molecular formula C32H20N6O12 and a molecular weight of 680.54 g/mol. Its IUPAC name is N-[4-[3-[4-[(2,4-dinitrobenzoyl)amino]phenoxy]phenoxy]phenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[4-[3-[4-[(2,4-dinitrobenzoyl)amino]phenoxy]phenoxy]phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3095747 |
| Molecular Formula | C32H20N6O12 |
| Molecular Weight | 680.54 g/mol |
| Exact Mass | 680.11 |
| IUPAC Name | N-[4-[3-[4-[(2,4-dinitrobenzoyl)amino]phenoxy]phenoxy]phenyl]-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(Oc2cccc(Oc3ccc(NC(=O)c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)c2)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H20N6O12/c39-31(27-14-8-21(35(41)42)16-29(27)37(45)46)33-19-4-10-23(11-5-19)49-25-2-1-3-26(18-25)50-24-12-6-20(7-13-24)34-32(40)28-15-9-22(36(43)44)17-30(28)38(47)48/h1-18H,(H,33,39)(H,34,40) |
| InChIKey | UROHKYWOXFIFJY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 249.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|