C25H18N2O2S — CID 2234351
N-(3-cyano-4,5-diphenylfuran-2-yl)-2-phenylsulfanylacetamide (PubChem CID 2234351) has the molecular formula C25H18N2O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2234351 |
| Molecular Formula | C25H18N2O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-phenylsulfanylacetamide |
| SMILES | N#Cc1c(NC(=O)CSc2ccccc2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H18N2O2S/c26-16-21-23(18-10-4-1-5-11-18)24(19-12-6-2-7-13-19)29-25(21)27-22(28)17-30-20-14-8-3-9-15-20/h1-15H,17H2,(H,27,28) |
| InChIKey | BJESIILBCGQKGD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |