C29H28N2O2 — CID 108757680
2-(1-adamantyl)-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide (PubChem CID 108757680) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 108757680 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-(1-adamantyl)-N-(3-cyano-4,5-diphenylfuran-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CC23CC4CC(CC(C4)C2)C3)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H28N2O2/c30-18-24-26(22-7-3-1-4-8-22)27(23-9-5-2-6-10-23)33-28(24)31-25(32)17-29-14-19-11-20(15-29)13-21(12-19)16-29/h1-10,19-21H,11-17H2,(H,31,32) |
| InChIKey | FJSKKYCEBNJVLB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |