C27H22N2O3 — CID 108802771
N-(3-cyano-4,5-diphenylfuran-2-yl)-3-(4-methylphenoxy)propanamide (PubChem CID 108802771) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-3-(4-methylphenoxy)propanamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-3-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 108802771 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-3-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OCCC(=O)Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C27H22N2O3/c1-19-12-14-22(15-13-19)31-17-16-24(30)29-27-23(18-28)25(20-8-4-2-5-9-20)26(32-27)21-10-6-3-7-11-21/h2-15H,16-17H2,1H3,(H,29,30) |
| InChIKey | YCQLZCSZUCXHHQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |