C28H24N2O3 — CID 2422829
(2S)-N-[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]-2-phenoxypropanamide (PubChem CID 2422829) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is (2S)-N-[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]-2-phenoxypropanamide.
| Compound Name | (2S)-N-[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 2422829 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2S)-N-[3-cyano-4,5-bis(4-methylphenyl)furan-2-yl]-2-phenoxypropanamide |
| SMILES | Cc1ccc(-c2oc(NC(=O)[C@H](C)Oc3ccccc3)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H24N2O3/c1-18-9-13-21(14-10-18)25-24(17-29)28(33-26(25)22-15-11-19(2)12-16-22)30-27(31)20(3)32-23-7-5-4-6-8-23/h4-16,20H,1-3H3,(H,30,31)/t20-/m0/s1 |
| InChIKey | IWECEVKYRJSXQW-FQEVSTJZSA-N |
| XLogP | 6.51 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |