C26H19ClN2O3 — CID 108802318
3-(2-chlorophenoxy)-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide (PubChem CID 108802318) has the molecular formula C26H19ClN2O3 and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide.
| Compound Name | 3-(2-chlorophenoxy)-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 108802318 |
| Molecular Formula | C26H19ClN2O3 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-(3-cyano-4,5-diphenylfuran-2-yl)propanamide |
| SMILES | N#Cc1c(NC(=O)CCOc2ccccc2Cl)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H19ClN2O3/c27-21-13-7-8-14-22(21)31-16-15-23(30)29-26-20(17-28)24(18-9-3-1-4-10-18)25(32-26)19-11-5-2-6-12-19/h1-14H,15-16H2,(H,29,30) |
| InChIKey | XZMBSGDXXYSNGS-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |