C27H19N3O7 — CID 23735196
[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate (PubChem CID 23735196) has the molecular formula C27H19N3O7 and a molecular weight of 497.46 g/mol. Its IUPAC name is [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 23735196 |
| Molecular Formula | C27H19N3O7 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
| SMILES | N#Cc1c(NC(=O)COC(=O)COc2ccccc2[N+](=O)[O-])oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H19N3O7/c28-15-20-25(18-9-3-1-4-10-18)26(19-11-5-2-6-12-19)37-27(20)29-23(31)16-36-24(32)17-35-22-14-8-7-13-21(22)30(33)34/h1-14H,16-17H2,(H,29,31) |
| InChIKey | VRKYRBNLLCRFMY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|