C19H11F3N2O2 — CID 1102939
N-(3-cyano-4,5-diphenylfuran-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 1102939) has the molecular formula C19H11F3N2O2 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 1102939 |
| Molecular Formula | C19H11F3N2O2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1c(NC(=O)C(F)(F)F)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H11F3N2O2/c20-19(21,22)18(25)24-17-14(11-23)15(12-7-3-1-4-8-12)16(26-17)13-9-5-2-6-10-13/h1-10H,(H,24,25) |
| InChIKey | XRTJLYPXUOTKBJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |