C25H19N3O4S — CID 108757692
N-(3-cyano-4,5-diphenylfuran-2-yl)-4-(methanesulfonamido)benzamide (PubChem CID 108757692) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-4-(methanesulfonamido)benzamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 108757692 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C25H19N3O4S/c1-33(30,31)28-20-14-12-19(13-15-20)24(29)27-25-21(16-26)22(17-8-4-2-5-9-17)23(32-25)18-10-6-3-7-11-18/h2-15,28H,1H3,(H,27,29) |
| InChIKey | MHPGHNZGRRTMAQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |