C26H18ClN3O3 — CID 108757677
4-chloro-N-[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl]benzamide (PubChem CID 108757677) has the molecular formula C26H18ClN3O3 and a molecular weight of 455.90 g/mol. Its IUPAC name is 4-chloro-N-[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108757677 |
| Molecular Formula | C26H18ClN3O3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-chloro-N-[2-[(3-cyano-4,5-diphenylfuran-2-yl)amino]-2-oxoethyl]benzamide |
| SMILES | N#Cc1c(NC(=O)CNC(=O)c2ccc(Cl)cc2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H18ClN3O3/c27-20-13-11-19(12-14-20)25(32)29-16-22(31)30-26-21(15-28)23(17-7-3-1-4-8-17)24(33-26)18-9-5-2-6-10-18/h1-14H,16H2,(H,29,32)(H,30,31) |
| InChIKey | PSIHRAHNILZCDN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |