C25H20N2O5S — CID 108781749
N-(3-cyano-4,5-diphenylfuran-2-yl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 108781749) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 108781749 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C25H20N2O5S/c1-30-19-13-14-21(31-2)22(15-19)33(28,29)27-25-20(16-26)23(17-9-5-3-6-10-17)24(32-25)18-11-7-4-8-12-18/h3-15,27H,1-2H3 |
| InChIKey | GJLLCJVBRYUKCO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |