C30H23N3O4 — CID 108757691
N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 108757691) has the molecular formula C30H23N3O4 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 108757691 |
| Molecular Formula | C30H23N3O4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(3-cyano-4,5-diphenylfuran-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1oc(-c2ccccc2)c(-c2ccccc2)c1C#N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H23N3O4/c1-18(2)25(33-29(35)21-15-9-10-16-22(21)30(33)36)27(34)32-28-23(17-31)24(19-11-5-3-6-12-19)26(37-28)20-13-7-4-8-14-20/h3-16,18,25H,1-2H3,(H,32,34) |
| InChIKey | LQVCACUPAUQURO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|