C15H9ClN2O2S2 — CID 2392283
2-chloro-N-(3-cyano-4,5-dithiophen-2-ylfuran-2-yl)acetamide (PubChem CID 2392283) has the molecular formula C15H9ClN2O2S2 and a molecular weight of 348.84 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5-dithiophen-2-ylfuran-2-yl)acetamide.
| Compound Name | 2-chloro-N-(3-cyano-4,5-dithiophen-2-ylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 2392283 |
| Molecular Formula | C15H9ClN2O2S2 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5-dithiophen-2-ylfuran-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CCl)oc(-c2cccs2)c1-c1cccs1 |
| InChI | InChI=1S/C15H9ClN2O2S2/c16-7-12(19)18-15-9(8-17)13(10-3-1-5-21-10)14(20-15)11-4-2-6-22-11/h1-6H,7H2,(H,18,19) |
| InChIKey | JBBFTASYEYCWBZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|