C19H13N3O3 — CID 2346093
[2-(2-cyanoanilino)-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate (PubChem CID 2346093) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2346093 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
| SMILES | N#C/C(=C/c1ccccc1)C(=O)OCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C19H13N3O3/c20-11-15-8-4-5-9-17(15)22-18(23)13-25-19(24)16(12-21)10-14-6-2-1-3-7-14/h1-10H,13H2,(H,22,23)/b16-10- |
| InChIKey | GDDOPFPHONUIFF-YBEGLDIGSA-N |
| XLogP | 2.65 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|