C20H14N4O6 — CID 7506245
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 7506245) has the molecular formula C20H14N4O6 and a molecular weight of 406.35 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7506245 |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2C#N)cc1 |
| InChI | InChI=1S/C20H14N4O6/c1-29-17-5-2-13(3-6-17)8-15(11-22)20(26)30-12-19(25)23-18-7-4-16(24(27)28)9-14(18)10-21/h2-9H,12H2,1H3,(H,23,25)/b15-8+ |
| InChIKey | DGYKPUMCSRRTAK-OVCLIPMQSA-N |
| XLogP | 2.56 |
| TPSA | 155.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|