C19H14ClFN2O4 — CID 2381802
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 2381802) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2381802 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(/C#N)C(=O)OCC(=O)Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C19H14ClFN2O4/c1-26-15-5-2-12(3-6-15)8-13(10-22)19(25)27-11-18(24)23-17-7-4-14(21)9-16(17)20/h2-9H,11H2,1H3,(H,23,24)/b13-8- |
| InChIKey | YLTGTFNQXXMVHZ-JYRVWZFOSA-N |
| XLogP | 3.58 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|