C20H14ClN3O4 — CID 7868175
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 7868175) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7868175 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)OCC(=O)Nc2ccc(C#N)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H14ClN3O4/c1-27-17-6-2-13(3-7-17)8-15(11-23)20(26)28-12-19(25)24-16-5-4-14(10-22)18(21)9-16/h2-9H,12H2,1H3,(H,24,25)/b15-8+ |
| InChIKey | CAYVOIYMKKZYEL-OVCLIPMQSA-N |
| XLogP | 3.31 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|