C20H14N2O4 — CID 7812305
[2-(2-cyanoanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7812305) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7812305 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C20H14N2O4/c21-11-15-7-3-4-8-17(15)22-19(24)12-26-20(25)16-9-13-5-1-2-6-14(13)10-18(16)23/h1-10,23H,12H2,(H,22,24) |
| InChIKey | JFMKWMPVKCCVEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |