C18H16N2O5S — CID 8855154
[2-(2-cyanoanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8855154) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8855154 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C18H16N2O5S/c1-2-26(23,24)16-10-6-4-8-14(16)18(22)25-12-17(21)20-15-9-5-3-7-13(15)11-19/h3-10H,2,12H2,1H3,(H,20,21) |
| InChIKey | XEHBAAHDFNWPMS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |