C24H18N2O5 — CID 7521413
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 7521413) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 7521413 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1ccccc1-c1ccccc1C#N |
| InChI | InChI=1S/C24H18N2O5/c1-30-23(28)20-12-6-7-13-21(20)26-22(27)15-31-24(29)19-11-5-4-10-18(19)17-9-3-2-8-16(17)14-25/h2-13H,15H2,1H3,(H,26,27) |
| InChIKey | PKQHVKKYTMPBOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |