C23H17N3O4 — CID 9309799
[2-oxo-2-(phenylcarbamoylamino)ethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 9309799) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 9309799 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [2-oxo-2-(phenylcarbamoylamino)ethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)OCC(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H17N3O4/c24-14-16-8-4-5-11-18(16)19-12-6-7-13-20(19)22(28)30-15-21(27)26-23(29)25-17-9-2-1-3-10-17/h1-13H,15H2,(H2,25,26,27,29) |
| InChIKey | KTTCFNDVSSAFPF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |