C22H19N3O3 — CID 7522779
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 7522779) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 7522779 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)OCC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C22H19N3O3/c23-13-16-7-1-2-8-17(16)18-9-3-4-10-19(18)21(27)28-14-20(26)25-22(15-24)11-5-6-12-22/h1-4,7-10H,5-6,11-12,14H2,(H,25,26) |
| InChIKey | ALUXQSGWIGKDHD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |