C15H14ClFN2O3 — CID 8620571
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8620571) has the molecular formula C15H14ClFN2O3 and a molecular weight of 324.74 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620571 |
| Molecular Formula | C15H14ClFN2O3 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | N#CC1(NC(=O)COC(=O)c2cc(Cl)ccc2F)CCCC1 |
| InChI | InChI=1S/C15H14ClFN2O3/c16-10-3-4-12(17)11(7-10)14(21)22-8-13(20)19-15(9-18)5-1-2-6-15/h3-4,7H,1-2,5-6,8H2,(H,19,20) |
| InChIKey | HPQGXPSXUJCKLR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |