C16H17ClN2O3 — CID 7838701
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 7838701) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 7838701 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | N#CC1(NC(=O)COC(=O)c2cccc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C16H17ClN2O3/c17-13-6-4-5-12(9-13)15(21)22-10-14(20)19-16(11-18)7-2-1-3-8-16/h4-6,9H,1-3,7-8,10H2,(H,19,20) |
| InChIKey | DSJNWPDHWCXSTD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |