C17H18F2N2O4 — CID 7291016
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-(difluoromethoxy)benzoate (PubChem CID 7291016) has the molecular formula C17H18F2N2O4 and a molecular weight of 352.34 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7291016 |
| Molecular Formula | C17H18F2N2O4 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-(difluoromethoxy)benzoate |
| SMILES | N#CC1(NC(=O)COC(=O)c2ccc(OC(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C17H18F2N2O4/c18-16(19)25-13-6-4-12(5-7-13)15(23)24-10-14(22)21-17(11-20)8-2-1-3-9-17/h4-7,16H,1-3,8-10H2,(H,21,22) |
| InChIKey | QZGPTDMJOGYJHF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |