C15H17N3O4 — CID 7834014
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 7834014) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7834014 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)c2cc[n+]([O-])cc2)CCCCC1 |
| InChI | InChI=1S/C15H17N3O4/c16-11-15(6-2-1-3-7-15)17-13(19)10-22-14(20)12-4-8-18(21)9-5-12/h4-5,8-9H,1-3,6-7,10H2,(H,17,19) |
| InChIKey | RSRSZKIOXBYFPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|