C20H26N4O4 — CID 7735064
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 7735064) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 7735064 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)OCC(=O)NC2(C#N)CCCC2)cc1 |
| InChI | InChI=1S/C20H26N4O4/c1-14(2)23-19(27)22-11-15-5-7-16(8-6-15)18(26)28-12-17(25)24-20(13-21)9-3-4-10-20/h5-8,14H,3-4,9-12H2,1-2H3,(H,24,25)(H2,22,23,27) |
| InChIKey | GQDHSTRMKSLXPC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |