C16H22N4O5 — CID 8915474
[2-(2-acetylhydrazinyl)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 8915474) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 8915474 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(=O)NNC(=O)COC(=O)c1ccc(CNC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H22N4O5/c1-10(2)18-16(24)17-8-12-4-6-13(7-5-12)15(23)25-9-14(22)20-19-11(3)21/h4-7,10H,8-9H2,1-3H3,(H,19,21)(H,20,22)(H2,17,18,24) |
| InChIKey | VUTCEKJQPMRQBE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|