C18H26N4O5 — CID 7734994
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 7734994) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 7734994 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)OCC(=O)NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H26N4O5/c1-11(2)20-17(25)19-9-13-5-7-14(8-6-13)16(24)27-10-15(23)22-18(26)21-12(3)4/h5-8,11-12H,9-10H2,1-4H3,(H2,19,20,25)(H2,21,22,23,26) |
| InChIKey | YZQZBWMTNGCUTF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |