C16H22N4O5 — CID 7734953
[2-(methylcarbamoylamino)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 7734953) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 7734953 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(CNC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H22N4O5/c1-10(2)19-16(24)18-8-11-4-6-12(7-5-11)14(22)25-9-13(21)20-15(23)17-3/h4-7,10H,8-9H2,1-3H3,(H2,18,19,24)(H2,17,20,21,23) |
| InChIKey | WOQHWYZUEWHYLH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |