C23H22N2O4 — CID 7865547
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 7865547) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7865547 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | N#CC1(NC(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C23H22N2O4/c24-16-23(13-7-2-8-14-23)25-20(26)15-29-22(28)19-12-6-5-11-18(19)21(27)17-9-3-1-4-10-17/h1,3-6,9-12H,2,7-8,13-15H2,(H,25,26) |
| InChIKey | UIUZKBFWNTWYRU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |