C24H27N3O3 — CID 7752641
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate (PubChem CID 7752641) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
|---|---|
| PubChem CID | 7752641 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(2,3-dimethylanilino)benzoate |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)OCC(=O)NC2(C#N)CCCCC2)c1C |
| InChI | InChI=1S/C24H27N3O3/c1-17-9-8-12-20(18(17)2)26-21-11-5-4-10-19(21)23(29)30-15-22(28)27-24(16-25)13-6-3-7-14-24/h4-5,8-12,26H,3,6-7,13-15H2,1-2H3,(H,27,28) |
| InChIKey | HCBDYWHGJIGBEB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |