C18H19N3O3 — CID 8607284
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 8607284) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8607284 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)c2c[nH]c3ccccc23)CCCCC1 |
| InChI | InChI=1S/C18H19N3O3/c19-12-18(8-4-1-5-9-18)21-16(22)11-24-17(23)14-10-20-15-7-3-2-6-13(14)15/h2-3,6-7,10,20H,1,4-5,8-9,11H2,(H,21,22) |
| InChIKey | CBGWQELQNCBXNM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |