C23H20N2O3 — CID 7786656
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] anthracene-9-carboxylate (PubChem CID 7786656) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] anthracene-9-carboxylate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786656 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] anthracene-9-carboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)c2c3ccccc3cc3ccccc23)CCCC1 |
| InChI | InChI=1S/C23H20N2O3/c24-15-23(11-5-6-12-23)25-20(26)14-28-22(27)21-18-9-3-1-7-16(18)13-17-8-2-4-10-19(17)21/h1-4,7-10,13H,5-6,11-12,14H2,(H,25,26) |
| InChIKey | BDMHPRHKQJIZMU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|