C17H20F2N2O2 — CID 86922934
N-(1-cyanocyclohexyl)-3-[4-(difluoromethoxy)phenyl]propanamide (PubChem CID 86922934) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-3-[4-(difluoromethoxy)phenyl]propanamide.
| Compound Name | N-(1-cyanocyclohexyl)-3-[4-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 86922934 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-(1-cyanocyclohexyl)-3-[4-(difluoromethoxy)phenyl]propanamide |
| SMILES | N#CC1(NC(=O)CCc2ccc(OC(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C17H20F2N2O2/c18-16(19)23-14-7-4-13(5-8-14)6-9-15(22)21-17(12-20)10-2-1-3-11-17/h4-5,7-8,16H,1-3,6,9-11H2,(H,21,22) |
| InChIKey | FIOUUCMEJOXTKO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |