C16H19F2N3O2 — CID 36586094
N-(1-cyanocyclohexyl)-2-[4-(difluoromethoxy)anilino]acetamide (PubChem CID 36586094) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-(difluoromethoxy)anilino]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-(difluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 36586094 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-(difluoromethoxy)anilino]acetamide |
| SMILES | N#CC1(NC(=O)CNc2ccc(OC(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C16H19F2N3O2/c17-15(18)23-13-6-4-12(5-7-13)20-10-14(22)21-16(11-19)8-2-1-3-9-16/h4-7,15,20H,1-3,8-10H2,(H,21,22) |
| InChIKey | QCXUERYAMOEGBD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|