C10H11F2N3O3 — CID 43089723
N-carbamoyl-2-[4-(difluoromethoxy)anilino]acetamide (PubChem CID 43089723) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is N-carbamoyl-2-[4-(difluoromethoxy)anilino]acetamide.
| Compound Name | N-carbamoyl-2-[4-(difluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 43089723 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-carbamoyl-2-[4-(difluoromethoxy)anilino]acetamide |
| SMILES | NC(=O)NC(=O)CNc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C10H11F2N3O3/c11-9(12)18-7-3-1-6(2-4-7)14-5-8(16)15-10(13)17/h1-4,9,14H,5H2,(H3,13,15,16,17) |
| InChIKey | GGPJVOGOFNRDMV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|