C15H13F3N2O2 — CID 9098936
N-[4-(difluoromethoxy)phenyl]-2-(3-fluoroanilino)acetamide (PubChem CID 9098936) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(3-fluoroanilino)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(3-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 9098936 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(3-fluoroanilino)acetamide |
| SMILES | O=C(CNc1cccc(F)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O2/c16-10-2-1-3-12(8-10)19-9-14(21)20-11-4-6-13(7-5-11)22-15(17)18/h1-8,15,19H,9H2,(H,20,21) |
| InChIKey | XWCMZJCQXSWGFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |