C15H12F3NO3 — CID 2709478
N-[4-(difluoromethoxy)phenyl]-2-(3-fluorophenoxy)acetamide (PubChem CID 2709478) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2709478 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(3-fluorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(F)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H12F3NO3/c16-10-2-1-3-13(8-10)21-9-14(20)19-11-4-6-12(7-5-11)22-15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | NIHXPWSXYBQBTG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |